Difference between revisions of "DNA-containing-abasic-Sites"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-488 == * common-name: ** β-l-fucose 1-phosphate * smiles: ** cc1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: ** ptvxqarclqpg...") |
(Created page with "Category:metabolite == Metabolite DNA-containing-abasic-Sites == * common-name: ** a dna containing an apurinic/apyrimidinic site == Reaction(s) known to consume the compo...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DNA-containing-abasic-Sites == |
* common-name: | * common-name: | ||
| − | ** | + | ** a dna containing an apurinic/apyrimidinic site |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[4.2.99.18-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a dna containing an apurinic/apyrimidinic site}} |
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite DNA-containing-abasic-Sites
- common-name:
- a dna containing an apurinic/apyrimidinic site
