Difference between revisions of "S-Substituted-Glutathione"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MESO-DIAMINOPIMELATE == * common-name: ** meso-diaminopimelate * smiles: ** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o * inchi-key: ** gmkmezv...") |
(Created page with "Category:metabolite == Metabolite S-Substituted-Glutathione == * common-name: ** a glutathione-toxin conjugate == Reaction(s) known to consume the compound == * RXN-6641...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite S-Substituted-Glutathione == |
* common-name: | * common-name: | ||
| − | ** | + | ** a glutathione-toxin conjugate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-6641]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[GSHTRAN-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a glutathione-toxin conjugate}} |
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite S-Substituted-Glutathione
- common-name:
- a glutathione-toxin conjugate
