Difference between revisions of "OXALO-SUCCINATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite HIS-tRNAs == * common-name: ** a trnahis == Reaction(s) known to consume the compound == * HISTIDINE--TRNA-LIGASE-RXN == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite OXALO-SUCCINATE == * common-name: ** oxalosuccinate * smiles: ** c(c([o-])=o)c(c(c(=o)[o-])=o)c([o-])=o * inchi-key: ** ufscuaxltrfidc-uh...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite HIS-tRNAs ==
+
== Metabolite OXALO-SUCCINATE ==
 
* common-name:
 
* common-name:
** a trnahis
+
** oxalosuccinate
 +
* smiles:
 +
** c(c([o-])=o)c(c(c(=o)[o-])=o)c([o-])=o
 +
* inchi-key:
 +
** ufscuaxltrfidc-uhfffaoysa-k
 +
* molecular-weight:
 +
** 187.085
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HISTIDINE--TRNA-LIGASE-RXN]]
+
* [[RXN-8642]]
 +
* [[RXN-9951]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-8642]]
 +
* [[RXN-9951]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a trnahis}}
+
{{#set: common-name=oxalosuccinate}}
 +
{{#set: inchi-key=inchikey=ufscuaxltrfidc-uhfffaoysa-k}}
 +
{{#set: molecular-weight=187.085}}

Latest revision as of 11:16, 18 March 2021

Metabolite OXALO-SUCCINATE

  • common-name:
    • oxalosuccinate
  • smiles:
    • c(c([o-])=o)c(c(c(=o)[o-])=o)c([o-])=o
  • inchi-key:
    • ufscuaxltrfidc-uhfffaoysa-k
  • molecular-weight:
    • 187.085

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality