Difference between revisions of "CPD-17045"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ERYTHROSE-4P == * common-name: ** d-erythrose 4-phosphate * smiles: ** [ch](c(c(cop([o-])([o-])=o)o)o)=o * inchi-key: ** nghmdnpxvrffgs-i...") |
(Created page with "Category:metabolite == Metabolite CPD-17045 == * common-name: ** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine * smiles: ** c(o)c2(o)(nc(=o)c(o)(cc1(=cc=cc=c1)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-17045 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c2(o)(nc(=o)c(o)(cc1(=cc=cc=c1))nc(=o)2) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pxypzmrmtkvysm-vxgbxaggsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 266.253 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-15680]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pxypzmrmtkvysm-vxgbxaggsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=266.253}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-17045
- common-name:
- 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine
- smiles:
- c(o)c2(o)(nc(=o)c(o)(cc1(=cc=cc=c1))nc(=o)2)
- inchi-key:
- pxypzmrmtkvysm-vxgbxaggsa-n
- molecular-weight:
- 266.253
