Difference between revisions of "PWY-5857"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O 5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O] ==
+== Pathway PWY-5857 ==
+* taxonomic-range:
+** tax-1224
 * common-name:
-** prostaglandin d2
+** ubiquinol-10 biosynthesis (prokaryotic)
-* smiles:
+== Reaction(s) found ==
-** cccccc(o)c=cc1(c(=o)cc(o)c(cc=ccccc(=o)[o-])1)
+* [[RXN-9233]]
-* inchi-key:
+* [[RXN-9235]]
-** bhmbvrspmrccgg-outuxvnysa-m
+* [[RXN-9237]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 351.462
+* [NoneRXN-9234 RXN-9234]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-9232 RXN-9232]
-* [[1.1.1.188-RXN]]
+* [NoneRXN-9230 RXN-9230]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-9236 RXN-9236]
-* [[1.1.1.188-RXN]]
+* [NoneRXN-9231 RXN-9231]
-* [[PROSTAGLANDIN-D-SYNTHASE-RXN]]
+{{#set: taxonomic-range=tax-1224}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=ubiquinol-10 biosynthesis (prokaryotic)}}
-{{#set: common-name=prostaglandin d2}}
+{{#set: nb reaction found=3}}
-{{#set: inchi-key=inchikey=bhmbvrspmrccgg-outuxvnysa-m}}
+{{#set: completion rate=0.38}}
-{{#set: molecular-weight=351.462}}
+{{#set: nb total reaction=8}}