Difference between revisions of "PWY-5268"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-782 CPD-782] ==
+== Pathway PWY-5268 ==
+* taxonomic-range:
+** tax-3398
 * common-name:
-** 3,4-dihydroxyphenylacetate
+** salvianin biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c([o-])(=o)cc1(c=cc(=c(c=1)o)o)
+* [[RXN-7828]]
-* inchi-key:
+== Reaction(s) not found ==
-** cffzdzcdufsofz-uhfffaoysa-m
+* [NoneRXN-8139 RXN-8139]
-* molecular-weight:
+* [None2.3.1.172-RXN 2.3.1.172-RXN]
-** 167.141
+* [NoneRXN-8138 RXN-8138]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-8140 RXN-8140]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-7997 RXN-7997]
-* [[RXN6666-5]]
+{{#set: taxonomic-range=tax-3398}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=salvianin biosynthesis}}
-{{#set: common-name=3,4-dihydroxyphenylacetate}}
+{{#set: nb reaction found=1}}
-{{#set: inchi-key=inchikey=cffzdzcdufsofz-uhfffaoysa-m}}
+{{#set: completion rate=0.17}}
-{{#set: molecular-weight=167.141}}
+{{#set: nb total reaction=6}}