Difference between revisions of "PWY-6013"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15678 CPD-15678] == * common-name: ** 4-trans-3-oxo-undecenoyl-coa * smiles: ** ccccccc=cc(...")
(Created page with "Category:pathway == Pathway PWY-6013 == * taxonomic-range: ** tax-4751 ** tax-33090 * common-name: ** crepenynate biosynthesis == Reaction(s) found == * 1.14.99.33-RXN...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15678 CPD-15678] ==
+
== Pathway PWY-6013 ==
 +
* taxonomic-range:
 +
** tax-4751
 +
** tax-33090
 
* common-name:
 
* common-name:
** 4-trans-3-oxo-undecenoyl-coa
+
** crepenynate biosynthesis
* smiles:
+
== Reaction(s) found ==
** ccccccc=cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
* [[1.14.99.33-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** xbfqfvlnmjddng-dupkwvsksa-j
+
All reactions of this pathways are in present
* molecular-weight:
+
{{#set: taxonomic-range=tax-4751|tax-33090}}
** 943.749
+
{{#set: common-name=crepenynate biosynthesis}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
* [[RXN-14793]]
+
{{#set: completion rate=1.0}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb total reaction=1}}
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=4-trans-3-oxo-undecenoyl-coa}}
 
{{#set: inchi-key=inchikey=xbfqfvlnmjddng-dupkwvsksa-j}}
 
{{#set: molecular-weight=943.749}}
 

Latest revision as of 10:57, 18 March 2021

Pathway PWY-6013

  • taxonomic-range:
    • tax-4751
    • tax-33090
  • common-name:
    • crepenynate biosynthesis

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present