Difference between revisions of "PWY-5391"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-GLYCERO-PHOSPHORYLCHOLINE L-1-GLYCERO-PHOSPHORYLCHOLINE] ==
+== Pathway PWY-5391 ==
+* taxonomic-range:
+** tax-58024
 * common-name:
-** sn-glycero-3-phosphocholine
+** syringetin biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c([n+](c)(c)c)cop([o-])(=o)occ(o)co
+* [[RXN-8450]]
-* inchi-key:
+== Reaction(s) not found ==
-** suhoquvvvlnyqr-mrvpvssysa-n
+* [NoneRXN-8452 RXN-8452]
-* molecular-weight:
+* [NoneRXN-13718 RXN-13718]
-** 257.223
+* [NoneRXN-525 RXN-525]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-8451 RXN-8451]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-58024}}
-* [[LYSOPHOSPHOLIPASE-RXN]]
+{{#set: common-name=syringetin biosynthesis}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=1}}
-{{#set: common-name=sn-glycero-3-phosphocholine}}
+{{#set: completion rate=0.2}}
-{{#set: inchi-key=inchikey=suhoquvvvlnyqr-mrvpvssysa-n}}
+{{#set: nb total reaction=5}}
-{{#set: molecular-weight=257.223}}