Difference between revisions of "PWY-6827"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7953 CPD-7953] == * common-name: ** torulene * smiles: ** cc(=cc=cc(=cc=cc(=cc=cc(=cc=cc=c(...")
(Created page with "Category:pathway == Pathway PWY-6827 == * taxonomic-range: ** tax-2 * common-name: ** gellan degradation == Reaction(s) found == * RXN-12270 == Reaction(s) not found =...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7953 CPD-7953] ==
+
== Pathway PWY-6827 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** torulene
+
** gellan degradation
* smiles:
+
== Reaction(s) found ==
** cc(=cc=cc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)c)c)c)c)c
+
* [[RXN-12270]]
* inchi-key:
+
== Reaction(s) not found ==
** aibohnyykwyqmm-mxbsltgdsa-n
+
* [NoneRXN-12269 RXN-12269]
* molecular-weight:
+
{{#set: taxonomic-range=tax-2}}
** 534.867
+
{{#set: common-name=gellan degradation}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
* [[RXN-11989]]
+
{{#set: completion rate=0.5}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb total reaction=2}}
* [[RXN-11976]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=torulene}}
 
{{#set: inchi-key=inchikey=aibohnyykwyqmm-mxbsltgdsa-n}}
 
{{#set: molecular-weight=534.867}}
 

Latest revision as of 10:57, 18 March 2021

Pathway PWY-6827

  • taxonomic-range:
    • tax-2
  • common-name:
    • gellan degradation

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-12269 RXN-12269]