Difference between revisions of "PWY-6654"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12658 CPD-12658] ==
+== Pathway PWY-6654 ==
+* taxonomic-range:
+** tax-2157
 * common-name:
-** riboflavin cyclic-4',5'-phosphate
+** phosphopantothenate biosynthesis iii (archaebacteria)
-* smiles:
+== Reaction(s) found ==
-** cc3(c=c2(n=c4(c(=o)n=c(o)n=c(n(cc(o)c(o)c1(cop([o-])(=o)o1))c2=cc(c)=3)4)))
+* [[2-DEHYDROPANTOATE-REDUCT-RXN]]
-* inchi-key:
+* [[RXN-15635]]
-** cvzkydyrjqyydj-mbnywofbsa-m
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-11781 RXN-11781]
-** 437.325
+* [NoneRXN-11782 RXN-11782]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2157}}
-* [[RXN-11695]]
+{{#set: common-name=phosphopantothenate biosynthesis iii (archaebacteria)}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=2}}
-* [[RXN-11695]]
+{{#set: completion rate=0.5}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=4}}
-{{#set: common-name=riboflavin cyclic-4',5'-phosphate}}
-{{#set: inchi-key=inchikey=cvzkydyrjqyydj-mbnywofbsa-m}}
-{{#set: molecular-weight=437.325}}