Difference between revisions of "PWY-7790"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11674 CPD-11674] ==
+== Pathway PWY-7790 ==
+* taxonomic-range:
+** tax-33682
+** tax-4751
+** tax-2
 * common-name:
-** 5-hydroxytryptophol sulfate
+** ump biosynthesis ii
-* smiles:
+== Reaction(s) found ==
-** c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2))
+* [[ASPCARBTRANS-RXN]]
-* inchi-key:
+* [[CARBPSYN-RXN]]
-** focuajyuoxsnds-uhfffaoysa-m
+* [[DIHYDROOROT-RXN]]
-* molecular-weight:
+* [[OROPRIBTRANS-RXN]]
-** 256.253
+* [[OROTPDECARB-RXN]]
-== Reaction(s) known to consume the compound ==
+== Reaction(s) not found ==
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-13202 RXN-13202]
-* [[RXN-10782]]
+* [NoneRXN-9929 RXN-9929]
-== Reaction(s) of unknown directionality ==
+* [NoneGLUTAMIN-RXN GLUTAMIN-RXN]
-{{#set: common-name=5-hydroxytryptophol sulfate}}
+{{#set: taxonomic-range=tax-4751|tax-33682|tax-2}}
-{{#set: inchi-key=inchikey=focuajyuoxsnds-uhfffaoysa-m}}
+{{#set: common-name=ump biosynthesis ii}}
-{{#set: molecular-weight=256.253}}
+{{#set: nb reaction found=5}}
+{{#set: completion rate=0.71}}
+{{#set: nb total reaction=7}}