Difference between revisions of "P281-PWY"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRANS-23-DEHYDROADIPYL-COA TRANS-23-DEHYDROADIPYL-COA] ==
+== Pathway P281-PWY ==
+* taxonomic-range:
+** tax-2157
+** tax-2
 * common-name:
-** trans-2,3-dehydroadipyl-coa
+** 3-phenylpropanoate degradation
-* smiles:
+== Reaction(s) found ==
-** cc(c)(c(o)c(=o)nccc(=o)nccsc(c=cccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[RXN-2006]]
-* inchi-key:
+== Reaction(s) not found ==
-** zfxickrxpztfpb-kcqrsjhasa-i
+* [NoneR241-RXN R241-RXN]
-* molecular-weight:
+* [NoneR242-RXN R242-RXN]
-** 888.606
+* [NoneR246-RXN R246-RXN]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-2002 RXN-2002]
-* [[RXN-2425]]
+* [None1.14.13.58-RXN 1.14.13.58-RXN]
-== Reaction(s) known to produce the compound ==
+* [NoneR244-RXN R244-RXN]
-* [[RXN-2425]]
+{{#set: taxonomic-range=tax-2|tax-2157}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=3-phenylpropanoate degradation}}
-{{#set: common-name=trans-2,3-dehydroadipyl-coa}}
+{{#set: nb reaction found=1}}
-{{#set: inchi-key=inchikey=zfxickrxpztfpb-kcqrsjhasa-i}}
+{{#set: completion rate=0.14}}
-{{#set: molecular-weight=888.606}}
+{{#set: nb total reaction=7}}