Difference between revisions of "PWY-5815"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14601 CPD-14601] == * common-name: ** mycophenolate * smiles: ** cc(ccc([o-])=o)=ccc1(=c(c(...")
(Created page with "Category:pathway == Pathway PWY-5815 == * taxonomic-range: ** tax-33090 * common-name: ** rubber biosynthesis == Reaction(s) found == * RXN0-5180 == Reaction(s) not fo...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14601 CPD-14601] ==
+
== Pathway PWY-5815 ==
 +
* taxonomic-range:
 +
** tax-33090
 
* common-name:
 
* common-name:
** mycophenolate
+
** rubber biosynthesis
* smiles:
+
== Reaction(s) found ==
** cc(ccc([o-])=o)=ccc1(=c(c(c)=c2(coc(=o)c(=c(o)1)2))oc)
+
* [[RXN0-5180]]
* inchi-key:
+
== Reaction(s) not found ==
** hpnsfsbzbahari-rudmxatfsa-m
+
* [NoneRXN-9137 RXN-9137]
* molecular-weight:
+
{{#set: taxonomic-range=tax-33090}}
** 319.333
+
{{#set: common-name=rubber biosynthesis}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
* [[RXN-13607]]
+
{{#set: completion rate=0.5}}
* [[RXN-13608]]
+
{{#set: nb total reaction=2}}
== Reaction(s) known to produce the compound ==
 
* [[RXN-13605]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=mycophenolate}}
 
{{#set: inchi-key=inchikey=hpnsfsbzbahari-rudmxatfsa-m}}
 
{{#set: molecular-weight=319.333}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY-5815

  • taxonomic-range:
    • tax-33090
  • common-name:
    • rubber biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-9137 RXN-9137]