Difference between revisions of "PWY-5098"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SUCCINYL-L-HOMOSERINE O-SUCCINYL-L-HOMOSERINE] == * common-name: ** o-succinyl-l-homoserine *...")
(Created page with "Category:pathway == Pathway PWY-5098 == * taxonomic-range: ** tax-33090 * common-name: ** chlorophyll a degradation i == Reaction(s) found == * RXN-17252 * [[RXN-7741]...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SUCCINYL-L-HOMOSERINE O-SUCCINYL-L-HOMOSERINE] ==
+
== Pathway PWY-5098 ==
 +
* taxonomic-range:
 +
** tax-33090
 
* common-name:
 
* common-name:
** o-succinyl-l-homoserine
+
** chlorophyll a degradation i
* smiles:
+
== Reaction(s) found ==
** c(cc(=o)occc(c([o-])=o)[n+])c([o-])=o
+
* [[RXN-17252]]
* inchi-key:
+
* [[RXN-7741]]
** gnisqjgxjidkdj-yfkpbyrvsa-m
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NoneRXN-17253 RXN-17253]
** 218.186
+
* [NoneRXN-7738 RXN-7738]
== Reaction(s) known to consume the compound ==
+
* [None3.1.1.82-RXN 3.1.1.82-RXN]
* [[METBALT-RXN]]
+
* [NoneRXN-7739 RXN-7739]
* [[O-SUCCHOMOSERLYASE-RXN]]
+
{{#set: taxonomic-range=tax-33090}}
* [[RXN-9384]]
+
{{#set: common-name=chlorophyll a degradation i}}
* [[SUCHMSSELCYSL]]
+
{{#set: nb reaction found=2}}
* [[SUCHMSSELCYSLh]]
+
{{#set: completion rate=0.33}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb total reaction=6}}
* [[HOMSUCTRAN-RXN]]
 
* [[O-SUCCHOMOSERLYASE-RXN]]
 
* [[RXN-9384]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=o-succinyl-l-homoserine}}
 
{{#set: inchi-key=inchikey=gnisqjgxjidkdj-yfkpbyrvsa-m}}
 
{{#set: molecular-weight=218.186}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY-5098

  • taxonomic-range:
    • tax-33090
  • common-name:
    • chlorophyll a degradation i

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-17253 RXN-17253]
  • [NoneRXN-7738 RXN-7738]
  • [None3.1.1.82-RXN 3.1.1.82-RXN]
  • [NoneRXN-7739 RXN-7739]