Difference between revisions of "TRPSYN-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] == * common-name: ** urate * smiles: ** c12(nc(=o)nc=1c(=o)nc(=o)n2) * inchi-key:...") |
(Created page with "Category:pathway == Pathway TRPSYN-PWY == * taxonomic-range: ** tax-4751 ** tax-2157 ** tax-2 ** tax-3193 * common-name: ** l-tryptophan biosynthesis == Reaction(s) found...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:pathway]] |
− | == | + | == Pathway TRPSYN-PWY == |
+ | * taxonomic-range: | ||
+ | ** tax-4751 | ||
+ | ** tax-2157 | ||
+ | ** tax-2 | ||
+ | ** tax-3193 | ||
* common-name: | * common-name: | ||
− | ** | + | ** l-tryptophan biosynthesis |
− | + | == Reaction(s) found == | |
− | + | * [[ANTHRANSYN-RXN]] | |
− | + | * [[IGPSYN-RXN]] | |
− | + | * [[PRAISOM-RXN]] | |
− | + | * [[PRTRANS-RXN]] | |
− | + | * [[RXN0-2381]] | |
− | == Reaction(s) | + | * [[RXN0-2382]] |
− | * [[ | + | == Reaction(s) not found == |
− | * [[ | + | All reactions of this pathways are in present |
− | + | {{#set: taxonomic-range=tax-4751|tax-2|tax-3193|tax-2157}} | |
− | * [[ | + | {{#set: common-name=l-tryptophan biosynthesis}} |
− | * [[ | + | {{#set: nb reaction found=6}} |
− | * [[ | + | {{#set: completion rate=1.0}} |
− | == Reaction(s) of | + | {{#set: nb total reaction=6}} |
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: |
Latest revision as of 10:58, 18 March 2021
Pathway TRPSYN-PWY
- taxonomic-range:
- tax-4751
- tax-2157
- tax-2
- tax-3193
- common-name:
- l-tryptophan biosynthesis
Reaction(s) found
Reaction(s) not found
All reactions of this pathways are in present