Difference between revisions of "PWY-6657"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BUTYRYL-COA BUTYRYL-COA] == * common-name: ** butanoyl-coa * smiles: ** cccc(=o)sccnc(=o)ccnc(=...")
 
(Created page with "Category:pathway == Pathway PWY-6657 == * taxonomic-range: ** tax-2157 ** tax-2 * common-name: ** polyhydroxydecanoate biosynthesis == Reaction(s) found == * RXN-11797...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BUTYRYL-COA BUTYRYL-COA] ==
+
== Pathway PWY-6657 ==
 +
* taxonomic-range:
 +
** tax-2157
 +
** tax-2
 
* common-name:
 
* common-name:
** butanoyl-coa
+
** polyhydroxydecanoate biosynthesis
* smiles:
+
== Reaction(s) found ==
** cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
* [[RXN-11797]]
* inchi-key:
+
* [[RXN-7699]]
** crfngmnykdxrtn-hdrjhvaisa-j
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NoneRXN-11796 RXN-11796]
** 833.593
+
{{#set: taxonomic-range=tax-2|tax-2157}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=polyhydroxydecanoate biosynthesis}}
* [[ACACT2h]]
+
{{#set: nb reaction found=2}}
* [[ACOA40OR]]
+
{{#set: completion rate=0.67}}
* [[ACOAD1f]]
+
{{#set: nb total reaction=3}}
* [[RXN-12565]]
 
* [[RXN-13029]]
 
== Reaction(s) known to produce the compound ==
 
* [[ACOAD1f]]
 
* [[ACOAR1h]]
 
* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
 
* [[RXN-12558]]
 
* [[RXN-13029]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=butanoyl-coa}}
 
{{#set: inchi-key=inchikey=crfngmnykdxrtn-hdrjhvaisa-j}}
 
{{#set: molecular-weight=833.593}}
 

Latest revision as of 11:00, 18 March 2021

Pathway PWY-6657

  • taxonomic-range:
    • tax-2157
    • tax-2
  • common-name:
    • polyhydroxydecanoate biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-11796 RXN-11796]