Difference between revisions of "PWY-7410"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12199 CPD-12199] ==
+== Pathway PWY-7410 ==
+* taxonomic-range:
+** tax-50557
 * common-name:
-** 3s-(4-hydroxyphenyl)-3-hydroxy-propanoyl-coa
+** ipsdienol biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(o)c1(=cc=c(o)c=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+* [[GPPSYN-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** vddfxumtxcqmfm-ugdqnksbsa-j
+* [NoneRXN-15039 RXN-15039]
-* molecular-weight:
+* [NoneRXN-15040 RXN-15040]
-** 927.663
+* [NoneRXN-5110 RXN-5110]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-50557}}
-* [[RXN-11245]]
+{{#set: common-name=ipsdienol biosynthesis}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN-11244]]
+{{#set: completion rate=0.25}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=4}}
-{{#set: common-name=3s-(4-hydroxyphenyl)-3-hydroxy-propanoyl-coa}}
-{{#set: inchi-key=inchikey=vddfxumtxcqmfm-ugdqnksbsa-j}}
-{{#set: molecular-weight=927.663}}