Difference between revisions of "PWY-40"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12706 CPD-12706] == * common-name: ** 5-fluoro-5-deoxy-d-ribose 1-phosphate * smiles: ** c(...")
(Created page with "Category:pathway == Pathway PWY-40 == * taxonomic-range: ** tax-7742 ** tax-2 * common-name: ** putrescine biosynthesis i == Reaction(s) found == * AGMATIN-RXN * ARG...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12706 CPD-12706] ==
+
== Pathway PWY-40 ==
 +
* taxonomic-range:
 +
** tax-7742
 +
** tax-2
 
* common-name:
 
* common-name:
** 5-fluoro-5-deoxy-d-ribose 1-phosphate
+
** putrescine biosynthesis i
* smiles:
+
== Reaction(s) found ==
** c(c1(oc(op([o-])(=o)[o-])c(o)c1o))f
+
* [[AGMATIN-RXN]]
* inchi-key:
+
* [[ARGDECARBOX-RXN]]
** luqfmenctwebsq-txicztdvsa-l
+
== Reaction(s) not found ==
* molecular-weight:
+
All reactions of this pathways are in present
** 230.086
+
{{#set: taxonomic-range=tax-7742|tax-2}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=putrescine biosynthesis i}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=2}}
* [[RXN-11743]]
+
{{#set: completion rate=1.0}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb total reaction=2}}
{{#set: common-name=5-fluoro-5-deoxy-d-ribose 1-phosphate}}
 
{{#set: inchi-key=inchikey=luqfmenctwebsq-txicztdvsa-l}}
 
{{#set: molecular-weight=230.086}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY-40

  • taxonomic-range:
    • tax-7742
    • tax-2
  • common-name:
    • putrescine biosynthesis i

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present