Difference between revisions of "PWY-7455"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19170 CPD-19170] == * common-name: ** (2e,7z)-hexadecenoyl-coa * smiles: ** ccccccccc=ccccc...")
(Created page with "Category:pathway == Pathway PWY-7455 == * taxonomic-range: ** tax-40674 * common-name: ** allopregnanolone biosynthesis == Reaction(s) found == * PROGESTERONE-5-ALPHA-RE...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19170 CPD-19170] ==
+
== Pathway PWY-7455 ==
 +
* taxonomic-range:
 +
** tax-40674
 
* common-name:
 
* common-name:
** (2e,7z)-hexadecenoyl-coa
+
** allopregnanolone biosynthesis
* smiles:
+
== Reaction(s) found ==
** ccccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
* [[PROGESTERONE-5-ALPHA-REDUCTASE-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** yqarrkbgbkpbcx-dvzfgldusa-j
+
* [NoneRXN66-567 RXN66-567]
* molecular-weight:
+
{{#set: taxonomic-range=tax-40674}}
** 997.883
+
{{#set: common-name=allopregnanolone biosynthesis}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
* [[RXN-17780]]
+
{{#set: completion rate=0.5}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb total reaction=2}}
* [[RXN-17779]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=(2e,7z)-hexadecenoyl-coa}}
 
{{#set: inchi-key=inchikey=yqarrkbgbkpbcx-dvzfgldusa-j}}
 
{{#set: molecular-weight=997.883}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY-7455

  • taxonomic-range:
    • tax-40674
  • common-name:
    • allopregnanolone biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN66-567 RXN66-567]