Difference between revisions of "PWY-5394"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17331 CPD-17331] ==
+== Pathway PWY-5394 ==
+* taxonomic-range:
+** tax-4751
+** tax-3524
 * common-name:
-** (9z,12z,15z,18z,21z)-tetracosapentaenoyl-coa
+** betalamic acid biosynthesis
-* smiles:
+== Reaction(s) found ==
-** ccc=ccc=ccc=ccc=ccc=ccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+* [[RXN-8460]]
-* inchi-key:
+== Reaction(s) not found ==
-** bnamtmvbovnnsh-afqbpcmksa-j
+* [NoneTYROSINE-3-MONOOXYGENASE-RXN TYROSINE-3-MONOOXYGENASE-RXN]
-* molecular-weight:
+* [NoneRXN-8461 RXN-8461]
-** 1104.05
+{{#set: taxonomic-range=tax-4751|tax-3524}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=betalamic acid biosynthesis}}
-* [[RXN-16132]]
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.33}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=3}}
-{{#set: common-name=(9z,12z,15z,18z,21z)-tetracosapentaenoyl-coa}}
-{{#set: inchi-key=inchikey=bnamtmvbovnnsh-afqbpcmksa-j}}
-{{#set: molecular-weight=1104.05}}