Difference between revisions of "PWY-5084"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] == * common-name: ** phytenate * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=cc(...")
(Created page with "Category:pathway == Pathway PWY-5084 == * taxonomic-range: ** tax-2759 ** tax-2 ** tax-2157 * common-name: ** 2-oxoglutarate decarboxylation to succinyl-coa == Reaction(s)...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] ==
+
== Pathway PWY-5084 ==
 +
* taxonomic-range:
 +
** tax-2759
 +
** tax-2
 +
** tax-2157
 
* common-name:
 
* common-name:
** phytenate
+
** 2-oxoglutarate decarboxylation to succinyl-coa
* smiles:
+
== Reaction(s) found ==
** cc(c)cccc(c)cccc(c)cccc(c)=cc(=o)[o-]
+
* [[2OXOGLUTDECARB-RXN]]
* inchi-key:
+
* [[RXN-7716]]
** wdwbnnbrpveeod-pfxvradusa-m
+
* [[RXN0-1147]]
* molecular-weight:
+
== Reaction(s) not found ==
** 309.511
+
All reactions of this pathways are in present
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-2|tax-2157|tax-2759}}
* [[RXN66-480]]
+
{{#set: common-name=2-oxoglutarate decarboxylation to succinyl-coa}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=3}}
* [[RXN66-479]]
+
{{#set: completion rate=1.0}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb total reaction=3}}
{{#set: common-name=phytenate}}
 
{{#set: inchi-key=inchikey=wdwbnnbrpveeod-pfxvradusa-m}}
 
{{#set: molecular-weight=309.511}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY-5084

  • taxonomic-range:
    • tax-2759
    • tax-2
    • tax-2157
  • common-name:
    • 2-oxoglutarate decarboxylation to succinyl-coa

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present