Difference between revisions of "PWY-4942"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAQUINONE DOPAQUINONE] == * common-name: ** dopaquinone * smiles: ** c([o-])(=o)c([n+])cc1(=c...")
(Created page with "Category:pathway == Pathway PWY-4942 == * taxonomic-range: ** tax-3193 * common-name: ** sterculate biosynthesis == Reaction(s) found == * RXN-7421 == Reaction(s) not...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAQUINONE DOPAQUINONE] ==
+
== Pathway PWY-4942 ==
 +
* taxonomic-range:
 +
** tax-3193
 
* common-name:
 
* common-name:
** dopaquinone
+
** sterculate biosynthesis
* smiles:
+
== Reaction(s) found ==
** c([o-])(=o)c([n+])cc1(=cc(=o)c(=o)c=c1)
+
* [[RXN-7421]]
* inchi-key:
+
== Reaction(s) not found ==
** ahmiduvksgchau-lurjtmiesa-n
+
* [NoneRXN-7422 RXN-7422]
* molecular-weight:
+
{{#set: taxonomic-range=tax-3193}}
** 195.174
+
{{#set: common-name=sterculate biosynthesis}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=0.5}}
* [[MONOPHENOL-MONOOXYGENASE-RXN]]
+
{{#set: nb total reaction=2}}
* [[RXN-13061]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=dopaquinone}}
 
{{#set: inchi-key=inchikey=ahmiduvksgchau-lurjtmiesa-n}}
 
{{#set: molecular-weight=195.174}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY-4942

  • taxonomic-range:
    • tax-3193
  • common-name:
    • sterculate biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-7422 RXN-7422]