Difference between revisions of "PWY-6848"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] ==
+== Pathway PWY-6848 ==
+* taxonomic-range:
+** tax-4751
 * common-name:
-** 6,7-dehydrobaicalein
+** rutin degradation
-* smiles:
+== Reaction(s) found ==
-** c1(c=cc(=cc=1)c2(=cc(=o)c3(c(o2)=cc(=o)c(=o)c(o)=3)))
+* [[QUERCETIN-23-DIOXYGENASE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** lsqwciyrgvwpfx-uhfffaoysa-n
+* [NoneRXN-12530 RXN-12530]
-* molecular-weight:
+* [NoneRXN-12531 RXN-12531]
-** 268.225
+{{#set: taxonomic-range=tax-4751}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=rutin degradation}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN-14240]]
+{{#set: completion rate=0.33}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=3}}
-{{#set: common-name=6,7-dehydrobaicalein}}
-{{#set: inchi-key=inchikey=lsqwciyrgvwpfx-uhfffaoysa-n}}
-{{#set: molecular-weight=268.225}}