Difference between revisions of "PWY-6035"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP-CHOLINE CDP-CHOLINE] ==
+== Pathway PWY-6035 ==
+* taxonomic-range:
+** tax-33090
 * common-name:
-** cdp-choline
+** 2,3-cis-flavanols biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c[n+](c)(c)ccop([o-])(=o)op([o-])(=o)occ1(oc(c(o)c(o)1)n2(c=cc(=nc2=o)n))
+* [[RXN-9725]]
-* inchi-key:
+== Reaction(s) not found ==
-** rzzpdxzprhqocg-ojakkhqrsa-m
+* [NoneRXN-9723 RXN-9723]
-* molecular-weight:
+* [NoneRXN-9724 RXN-9724]
-** 487.319
+{{#set: taxonomic-range=tax-33090}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=2,3-cis-flavanols biosynthesis}}
-* [[CERAMIDE-CHOLINEPHOSPHOTRANSFERASE-RXN]]
+{{#set: nb reaction found=1}}
-* [[RXN-17733]]
+{{#set: completion rate=0.33}}
-* [[RXN-5781]]
+{{#set: nb total reaction=3}}
-* [[RXN-9614]]
-* [[RXN66-578]]
-== Reaction(s) known to produce the compound ==
-* [[2.7.7.15-RXN]]
-* [[CERAMIDE-CHOLINEPHOSPHOTRANSFERASE-RXN]]
-* [[CHLPCTDh]]
-* [[RXN-5781]]
-* [[RXN-9614]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=cdp-choline}}
-{{#set: inchi-key=inchikey=rzzpdxzprhqocg-ojakkhqrsa-m}}
-{{#set: molecular-weight=487.319}}