Difference between revisions of "PWY-5901"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11407 CPD-11407] == * common-name: ** thyroxine sulfate * smiles: ** c2(c(i)=c(oc1(c=c(c(os...")
(Created page with "Category:pathway == Pathway PWY-5901 == * taxonomic-range: ** tax-2 * common-name: ** 2,3-dihydroxybenzoate biosynthesis == Reaction(s) found == * DHBDEHYD-RXN * ISO...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11407 CPD-11407] ==
+
== Pathway PWY-5901 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** thyroxine sulfate
+
** 2,3-dihydroxybenzoate biosynthesis
* smiles:
+
== Reaction(s) found ==
** c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)
+
* [[DHBDEHYD-RXN]]
* inchi-key:
+
* [[ISOCHORSYN-RXN]]
** qyxijuzwssqict-lbprgkrzsa-m
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NoneISOCHORMAT-RXN ISOCHORMAT-RXN]
** 855.924
+
{{#set: taxonomic-range=tax-2}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=2,3-dihydroxybenzoate biosynthesis}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=2}}
* [[RXN-10614]]
+
{{#set: completion rate=0.67}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb total reaction=3}}
{{#set: common-name=thyroxine sulfate}}
 
{{#set: inchi-key=inchikey=qyxijuzwssqict-lbprgkrzsa-m}}
 
{{#set: molecular-weight=855.924}}
 

Latest revision as of 10:59, 18 March 2021

Pathway PWY-5901

  • taxonomic-range:
    • tax-2
  • common-name:
    • 2,3-dihydroxybenzoate biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneISOCHORMAT-RXN ISOCHORMAT-RXN]