Difference between revisions of "HISTSYN-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-HYDROXYMETHYL-METHYL-PYR-P AMINO-HYDROXYMETHYL-METHYL-PYR-P] == * common-name: ** 4-amino...")
(Created page with "Category:pathway == Pathway HISTSYN-PWY == * taxonomic-range: ** tax-2157 ** tax-4751 ** tax-33090 ** tax-2 * common-name: ** l-histidine biosynthesis == Reaction(s) found...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-HYDROXYMETHYL-METHYL-PYR-P AMINO-HYDROXYMETHYL-METHYL-PYR-P] ==
+
== Pathway HISTSYN-PWY ==
 +
* taxonomic-range:
 +
** tax-2157
 +
** tax-4751
 +
** tax-33090
 +
** tax-2
 
* common-name:
 
* common-name:
** 4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine
+
** l-histidine biosynthesis
* smiles:
+
== Reaction(s) found ==
** cc1(n=cc(cop(=o)([o-])[o-])=c(n=1)n)
+
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
* inchi-key:
+
* [[GLUTAMIDOTRANS-RXN]]
** pkyfhkiyhbrtpi-uhfffaoysa-l
+
* [[HISTALDEHYD-RXN]]
* molecular-weight:
+
* [[HISTAMINOTRANS-RXN]]
** 217.121
+
* [[HISTCYCLOHYD-RXN]]
== Reaction(s) known to consume the compound ==
+
* [[HISTIDPHOS-RXN]]
* [[PYRIMSYN3-RXN]]
+
* [[HISTOLDEHYD-RXN]]
== Reaction(s) known to produce the compound ==
+
* [[HISTPRATPHYD-RXN]]
* [[OHMETPYRKIN-RXN]]
+
* [[IMIDPHOSDEHYD-RXN]]
* [[PYRIMSYN1-RXN]]
+
* [[PRIBFAICARPISOM-RXN]]
== Reaction(s) of unknown directionality ==
+
== Reaction(s) not found ==
{{#set: common-name=4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine}}
+
All reactions of this pathways are in present
{{#set: inchi-key=inchikey=pkyfhkiyhbrtpi-uhfffaoysa-l}}
+
{{#set: taxonomic-range=tax-4751|tax-2|tax-2157|tax-33090}}
{{#set: molecular-weight=217.121}}
+
{{#set: common-name=l-histidine biosynthesis}}
 +
{{#set: nb reaction found=10}}
 +
{{#set: completion rate=1.0}}
 +
{{#set: nb total reaction=10}}

Latest revision as of 10:59, 18 March 2021

Pathway HISTSYN-PWY

  • taxonomic-range:
    • tax-2157
    • tax-4751
    • tax-33090
    • tax-2
  • common-name:
    • l-histidine biosynthesis

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present