Difference between revisions of "PWY1F-467"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LL-DIAMINOPIMELATE LL-DIAMINOPIMELATE] ==
+== Pathway PWY1F-467 ==
+* taxonomic-range:
+** tax-3398
 * common-name:
-** l,l-diaminopimelate
+** phenylpropanoid biosynthesis, initial reactions
-* smiles:
+== Reaction(s) found ==
-** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o
+* [[TRANS-CINNAMATE-4-MONOOXYGENASE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** gmkmezvlhjarhf-whfbiakzsa-n
+* [NonePHENYLALANINE-AMMONIA-LYASE-RXN PHENYLALANINE-AMMONIA-LYASE-RXN]
-* molecular-weight:
+{{#set: taxonomic-range=tax-3398}}
-** 190.199
+{{#set: common-name=phenylpropanoid biosynthesis, initial reactions}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[DIAMINOPIMEPIM-RXN]]
+{{#set: completion rate=0.5}}
-* [[RXN-7737]]
+{{#set: nb total reaction=2}}
-== Reaction(s) known to produce the compound ==
-* [[DIAMINOPIMEPIM-RXN]]
-* [[RXN-7737]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=l,l-diaminopimelate}}
-{{#set: inchi-key=inchikey=gmkmezvlhjarhf-whfbiakzsa-n}}
-{{#set: molecular-weight=190.199}}