Difference between revisions of "PWY-5441"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] ==
+== Pathway PWY-5441 ==
+* taxonomic-range:
+** tax-3193
 * common-name:
-** gdp-&beta;-l-fucose
+** s-methyl-l-methionine cycle
-* smiles:
+== Reaction(s) found ==
-** cc4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))([o-])=o)([o-])=o)c(c(c4o)o)o)
+* [[MMUM-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** lqebexmhblqmdb-jgqubwhwsa-l
+* [NoneMETHIONINE-S-METHYLTRANSFERASE-RXN METHIONINE-S-METHYLTRANSFERASE-RXN]
-* molecular-weight:
+{{#set: taxonomic-range=tax-3193}}
-** 587.33
+{{#set: common-name=s-methyl-l-methionine cycle}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[2.4.1.221-RXN]]
+{{#set: completion rate=0.5}}
-* [[2.4.1.68-RXN]]
+{{#set: nb total reaction=2}}
-* [[GALACTOSIDE-2-L-FUCOSYLTRANSFERASE-RXN]]
-* [[GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN]]
-* [[RXN-9463]]
-== Reaction(s) known to produce the compound ==
-* [[1.1.1.271-RXN]]
-* [[2.4.1.221-RXN]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=gdp-&beta;-l-fucose}}
-{{#set: inchi-key=inchikey=lqebexmhblqmdb-jgqubwhwsa-l}}
-{{#set: molecular-weight=587.33}}