Difference between revisions of "PWY-7765"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z13E-15S-1115-DIHYDROXY-9-OXOPROS 5Z13E-15S-1115-DIHYDROXY-9-OXOPROS] ==
+== Pathway PWY-7765 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** prostaglandin e2
+** 3-hydroxy-4-methyl-anthranilate biosynthesis ii
-* smiles:
+== Reaction(s) found ==
-** cccccc(o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1)
+* [[ARYLFORMAMIDASE-RXN]]
-* inchi-key:
+* [[KYNURENINE-3-MONOOXYGENASE-RXN]]
-** xeybrnlfezdvaw-arsrfyassa-m
+* [[RXN-8665]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 351.462
+* [NoneRXN-17499 RXN-17499]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-17500 RXN-17500]
-* [[1.1.1.141-RXN]]
+{{#set: taxonomic-range=tax-2}}
-* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
+{{#set: common-name=3-hydroxy-4-methyl-anthranilate biosynthesis ii}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=3}}
-* [[1.1.1.141-RXN]]
+{{#set: completion rate=0.6}}
-* [[PROSTAGLANDIN-E-SYNTHASE-RXN]]
+{{#set: nb total reaction=5}}
-* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=prostaglandin e2}}
-{{#set: inchi-key=inchikey=xeybrnlfezdvaw-arsrfyassa-m}}
-{{#set: molecular-weight=351.462}}