Difference between revisions of "PWY-7591"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9873 CPD-9873] ==
+== Pathway PWY-7591 ==
+* taxonomic-range:
+** tax-1046
 * common-name:
-** 3-demethylubiquinol-10
+** okenone biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(o)c(o)=c(c)1)
+* [[RXN1F-150]]
-* inchi-key:
+== Reaction(s) not found ==
-** vlmqnhnmqvlpqi-avrcvibksa-n
+* [NoneRXN-16056 RXN-16056]
-* molecular-weight:
+* [NoneRXN-16058 RXN-16058]
-** 851.347
+* [NoneRXN-16057 RXN-16057]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-16055 RXN-16055]
-* [[RXN-9237]]
+* [NoneRXN-12412 RXN-12412]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-1046}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=okenone biosynthesis}}
-{{#set: common-name=3-demethylubiquinol-10}}
+{{#set: nb reaction found=1}}
-{{#set: inchi-key=inchikey=vlmqnhnmqvlpqi-avrcvibksa-n}}
+{{#set: completion rate=0.17}}
-{{#set: molecular-weight=851.347}}
+{{#set: nb total reaction=6}}