Difference between revisions of "PWY-7746"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CAFFEOYL-COA CAFFEOYL-COA] ==
+== Pathway PWY-7746 ==
+* taxonomic-range:
+** tax-1762
 * common-name:
-** trans-caffeoyl-coa
+** mycobacterial sulfolipid biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=c(o)c(=c1)o))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+* [[RXN-9549]]
-* inchi-key:
+* [[RXN3O-9780]]
-** qhrgjmimhclhrg-zseliehesa-j
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-17319 RXN-17319]
-** 925.647
+* [NoneRXN-15426 RXN-15426]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-17318 RXN-17318]
-* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
+* [NoneRXN-17320 RXN-17320]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-17317 RXN-17317]
-* [[RXN-1126]]
+* [NoneRXN-17323 RXN-17323]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-18540 RXN-18540]
-{{#set: common-name=trans-caffeoyl-coa}}
+{{#set: taxonomic-range=tax-1762}}
-{{#set: inchi-key=inchikey=qhrgjmimhclhrg-zseliehesa-j}}
+{{#set: common-name=mycobacterial sulfolipid biosynthesis}}
-{{#set: molecular-weight=925.647}}
+{{#set: nb reaction found=2}}
+{{#set: completion rate=0.22}}
+{{#set: nb total reaction=9}}