Difference between revisions of "SJ06192"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] == * common-name: ** glycerophosphoserine * smiles: ** c(o)c(o)cop([o-])(o...")
(Created page with "Category:gene == Gene SJ06192 == * transcription-direction: ** positive * right-end-position: ** 905259 * left-end-position: ** 892493 * centisome-position: ** 95.84301...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] ==
+
== Gene SJ06192 ==
* common-name:
+
* transcription-direction:
** glycerophosphoserine
+
** positive
* smiles:
+
* right-end-position:
** c(o)c(o)cop([o-])(occ([n+])c(=o)[o-])=o
+
** 905259
* inchi-key:
+
* left-end-position:
** zwzwygmenqvnfu-uhnvwzdzsa-m
+
** 892493
* molecular-weight:
+
* centisome-position:
** 258.144
+
** 95.84301   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-14136]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[3.5.1.27-RXN]]
{{#set: common-name=glycerophosphoserine}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=zwzwygmenqvnfu-uhnvwzdzsa-m}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=258.144}}
+
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
* [[3.5.1.88-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=905259}}
 +
{{#set: left-end-position=892493}}
 +
{{#set: centisome-position=95.84301    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}

Latest revision as of 11:00, 18 March 2021

Gene SJ06192

  • transcription-direction:
    • positive
  • right-end-position:
    • 905259
  • left-end-position:
    • 892493
  • centisome-position:
    • 95.84301

Organism(s) associated with this gene

Reaction(s) associated