Difference between revisions of "SJ04746"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18492 CPD-18492] == * common-name: ** (2e,6z,9z,12z,15z,18z)-tetracosahexaenoyl-coa * smile...")
(Created page with "Category:gene == Gene SJ04746 == * transcription-direction: ** negative * right-end-position: ** 95613 * left-end-position: ** 87292 * centisome-position: ** 85.78898...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18492 CPD-18492] ==
+
== Gene SJ04746 ==
−
* common-name:
+
* transcription-direction:
−
** (2e,6z,9z,12z,15z,18z)-tetracosahexaenoyl-coa
+
** negative
−
* smiles:
+
* right-end-position:
−
** cccccc=ccc=ccc=ccc=ccc=cccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** 95613
−
* inchi-key:
+
* left-end-position:
−
** uyokhwfeuajfmg-uiyhdvlfsa-j
+
** 87292
−
* molecular-weight:
+
* centisome-position:
−
** 1102.034
+
** 85.78898   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-17114]]
+
* [[S.japonica_carotenoid_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
* [[RXN-17113]]
+
* [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
−
{{#set: common-name=(2e,6z,9z,12z,15z,18z)-tetracosahexaenoyl-coa}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: inchi-key=inchikey=uyokhwfeuajfmg-uiyhdvlfsa-j}}
+
== Pathway(s) associated ==
−
{{#set: molecular-weight=1102.034}}
+
* [[TRIGLSYN-PWY]]
 +
** '''5''' reactions found over '''7''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=95613}}
 +
{{#set: left-end-position=87292}}
 +
{{#set: centisome-position=85.78898    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:00, 18 March 2021

Gene SJ04746

  • transcription-direction:
    • negative
  • right-end-position:
    • 95613
  • left-end-position:
    • 87292
  • centisome-position:
    • 85.78898

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • TRIGLSYN-PWY
    • 5 reactions found over 7 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ04746&oldid=131680"