Difference between revisions of "SJ18177"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-METHYL-CROTONYL-COA 3-METHYL-CROTONYL-COA] == * common-name: ** 3-methylcrotonyl-coa * smiles...")
(Created page with "Category:gene == Gene SJ18177 == * transcription-direction: ** negative * right-end-position: ** 186007 * left-end-position: ** 180048 * centisome-position: ** 71.5945...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-METHYL-CROTONYL-COA 3-METHYL-CROTONYL-COA] ==
+
== Gene SJ18177 ==
−
* common-name:
+
* transcription-direction:
−
** 3-methylcrotonyl-coa
+
** negative
−
* smiles:
+
* right-end-position:
−
** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
+
** 186007
−
* inchi-key:
+
* left-end-position:
−
** bxipalatiynhjn-zmhdxicwsa-j
+
** 180048
−
* molecular-weight:
+
* centisome-position:
−
** 845.604
+
** 71.5945   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
+
* [[S.japonica_carotenoid_curated]]
−
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
+
== Reaction(s) associated ==
−
* [[RXN-14264]]
+
* [[GLYCINE-N-METHYLTRANSFERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
−
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[IVCDH]]
+
* [[RXN-13404]]
−
* [[RXN-11921]]
+
** Category: [[annotation]]
−
* [[RXN-14264]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN0-2301]]
+
* [[RXN-13405]]
−
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
−
{{#set: common-name=3-methylcrotonyl-coa}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: inchi-key=inchikey=bxipalatiynhjn-zmhdxicwsa-j}}
+
* [[RXN-13406]]
−
{{#set: molecular-weight=845.604}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-9679]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-9680]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[P541-PWY]]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
* [[PWY-6004]]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=186007}}
 +
{{#set: left-end-position=180048}}
 +
{{#set: centisome-position=71.5945    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=6}}
 +
{{#set: nb pathway associated=2}}

Latest revision as of 11:00, 18 March 2021

Gene SJ18177

  • transcription-direction:
    • negative
  • right-end-position:
    • 186007
  • left-end-position:
    • 180048
  • centisome-position:
    • 71.5945

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • P541-PWY
    • 3 reactions found over 3 reactions in the full pathway
  • PWY-6004
    • 3 reactions found over 3 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ18177&oldid=131731"