Difference between revisions of "SJ04949"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBULOSYL-FORMIMINO-AICAR-P PHOSPHORIBULOSYL-FORMIMINO-AICAR-P] == * common-name: ** pho...")
(Created page with "Category:gene == Gene SJ04949 == * transcription-direction: ** negative * right-end-position: ** 189145 * left-end-position: ** 177283 * centisome-position: ** 18.359234...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBULOSYL-FORMIMINO-AICAR-P PHOSPHORIBULOSYL-FORMIMINO-AICAR-P] ==
+
== Gene SJ04949 ==
* common-name:
+
* transcription-direction:
** phosphoribulosylformimino-aicar-phosphate
+
** negative
* smiles:
+
* right-end-position:
** c(op(=o)([o-])[o-])c(o)c(o)c(=o)cn=cnc2(n(c1(c(o)c(c(cop(=o)([o-])[o-])o1)o))c=nc(c(=o)n)=2)
+
** 189145
* inchi-key:
+
* left-end-position:
** blkfnhochnclii-ghvqhmavsa-j
+
** 177283
* molecular-weight:
+
* centisome-position:
** 573.303
+
** 18.359234   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[GLUTAMIDOTRANS-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-17900]]
+
== Reaction(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[SHIKIMATE-KINASE-RXN]]
* [[PRIBFAICARPISOM-RXN]]
+
** Category: [[annotation]]
* [[PRICI]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
== Reaction(s) of unknown directionality ==
+
** Category: [[orthology]]
{{#set: common-name=phosphoribulosylformimino-aicar-phosphate}}
+
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
{{#set: inchi-key=inchikey=blkfnhochnclii-ghvqhmavsa-j}}
+
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
{{#set: molecular-weight=573.303}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-6163]]
 +
** '''6''' reactions found over '''5''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=189145}}
 +
{{#set: left-end-position=177283}}
 +
{{#set: centisome-position=18.359234    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:01, 18 March 2021

Gene SJ04949

  • transcription-direction:
    • negative
  • right-end-position:
    • 189145
  • left-end-position:
    • 177283
  • centisome-position:
    • 18.359234

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6163
    • 6 reactions found over 5 reactions in the full pathway