Difference between revisions of "SJ00591"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DI-H-OROTATE DI-H-OROTATE] == * common-name: ** (s)-dihydroorotate * smiles: ** c1(c(=o)nc(=o)n...")
(Created page with "Category:gene == Gene SJ00591 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * H2Ot ** Category: or...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DI-H-OROTATE DI-H-OROTATE] ==
+
== Gene SJ00591 ==
* common-name:
+
== Organism(s) associated with this gene  ==
** (s)-dihydroorotate
+
* [[S.japonica_carotenoid_curated]]
* smiles:
+
== Reaction(s) associated ==
** c1(c(=o)nc(=o)nc(c(=o)[o-])1)
+
* [[H2Ot]]
* inchi-key:
+
** Category: [[orthology]]
** ufivepvsagbusi-reohclbhsa-m
+
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
* molecular-weight:
+
* [[H2Oth]]
** 157.105
+
** Category: [[orthology]]
== Reaction(s) known to consume the compound ==
+
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
* [[DIHYDROOROT-RXN]]
+
* [[H2Othu]]
* [[DIHYDROOROTATE-DEHYDROGENASE-RXN]]
+
** Category: [[orthology]]
* [[RXN0-6491]]
+
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
* [[RXN0-6554]]
+
* [[H2Otm]]
== Reaction(s) known to produce the compound ==
+
** Category: [[orthology]]
* [[DIHYDROOROT-RXN]]
+
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
== Reaction(s) of unknown directionality ==
+
* [[H2Otx]]
{{#set: common-name=(s)-dihydroorotate}}
+
** Category: [[orthology]]
{{#set: inchi-key=inchikey=ufivepvsagbusi-reohclbhsa-m}}
+
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
{{#set: molecular-weight=157.105}}
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=5}}

Latest revision as of 11:01, 18 March 2021

Gene SJ00591

Organism(s) associated with this gene

Reaction(s) associated