Difference between revisions of "SJ13312"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE-6P TREHALOSE-6P] == * common-name: ** α,α-trehalose 6-phosphate * smiles:...")
(Created page with "Category:gene == Gene SJ13312 == * transcription-direction: ** negative * right-end-position: ** 131172 * left-end-position: ** 124210 * centisome-position: ** 36.349216...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE-6P TREHALOSE-6P] ==
+
== Gene SJ13312 ==
* common-name:
+
* transcription-direction:
** α,α-trehalose 6-phosphate
+
** negative
* smiles:
+
* right-end-position:
** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)cop([o-])(=o)[o-])o)o)o)))o
+
** 131172
* inchi-key:
+
* left-end-position:
** labspybhmpdtel-lizsdcnhsa-l
+
** 124210
* molecular-weight:
+
* centisome-position:
** 420.263
+
** 36.349216   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[TREHALOSEPHOSPHA-RXN]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[TREHALOSE6PSYN-RXN]]
+
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
* [[UG6PGT]]
+
** Category: [[annotation]]
* [[UG6PGTn]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
== Reaction(s) of unknown directionality ==
+
== Pathway(s) associated ==
{{#set: common-name=α,α-trehalose 6-phosphate}}
+
* [[PWY-7511]]
{{#set: inchi-key=inchikey=labspybhmpdtel-lizsdcnhsa-l}}
+
** '''7''' reactions found over '''9''' reactions in the full pathway
{{#set: molecular-weight=420.263}}
+
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=131172}}
 +
{{#set: left-end-position=124210}}
 +
{{#set: centisome-position=36.349216    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:01, 18 March 2021

Gene SJ13312

  • transcription-direction:
    • negative
  • right-end-position:
    • 131172
  • left-end-position:
    • 124210
  • centisome-position:
    • 36.349216

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7511
    • 7 reactions found over 9 reactions in the full pathway