Difference between revisions of "SJ02880"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8775 CPD-8775] == * common-name: ** m-toluate * smiles: ** cc1(=cc(=cc=c1)c(=o)[o-]) * inch...") |
(Created page with "Category:gene == Gene SJ02880 == * transcription-direction: ** positive * right-end-position: ** 72520 * left-end-position: ** 50563 * centisome-position: ** 38.7878 =...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:gene]] |
− | == | + | == Gene SJ02880 == |
− | * | + | * transcription-direction: |
− | ** | + | ** positive |
− | * | + | * right-end-position: |
− | ** | + | ** 72520 |
− | * | + | * left-end-position: |
− | ** | + | ** 50563 |
− | * | + | * centisome-position: |
− | ** | + | ** 38.7878 |
− | == | + | == Organism(s) associated with this gene == |
− | == Reaction(s) | + | * [[S.japonica_carotenoid_curated]] |
− | * [[RXN | + | == Reaction(s) associated == |
− | == | + | * [[AMINO-CARBOXYMUCONATE-SEMIALDEHYDE-RXN]] |
− | {{#set: | + | ** Category: [[annotation]] |
− | {{#set: | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | {{#set: | + | == Pathway(s) associated == |
+ | * [[PWY-5654]] | ||
+ | ** '''1''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY-5652]] | ||
+ | ** '''2''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[PWY-5647]] | ||
+ | ** '''2''' reactions found over '''6''' reactions in the full pathway | ||
+ | {{#set: transcription-direction=positive}} | ||
+ | {{#set: right-end-position=72520}} | ||
+ | {{#set: left-end-position=50563}} | ||
+ | {{#set: centisome-position=38.7878 }} | ||
+ | {{#set: organism associated=S.japonica_carotenoid_curated}} | ||
+ | {{#set: nb reaction associated=1}} | ||
+ | {{#set: nb pathway associated=3}} |
Latest revision as of 11:01, 18 March 2021
Contents
Gene SJ02880
- transcription-direction:
- positive
- right-end-position:
- 72520
- left-end-position:
- 50563
- centisome-position:
- 38.7878
Organism(s) associated with this gene
Reaction(s) associated
- AMINO-CARBOXYMUCONATE-SEMIALDEHYDE-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
Pathway(s) associated
- PWY-5654
- 1 reactions found over 4 reactions in the full pathway
- PWY-5652
- 2 reactions found over 5 reactions in the full pathway
- PWY-5647
- 2 reactions found over 6 reactions in the full pathway