Difference between revisions of "SJ11813"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1162 CPD0-1162] == * common-name: ** (2e,5z)-tetradecenoyl-coa * smiles: ** ccccccccc=ccc=...")
(Created page with "Category:gene == Gene SJ11813 == * transcription-direction: ** positive * right-end-position: ** 235942 * left-end-position: ** 232417 * centisome-position: ** 63.401787...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1162 CPD0-1162] ==
+
== Gene SJ11813 ==
−
* common-name:
+
* transcription-direction:
−
** (2e,5z)-tetradecenoyl-coa
+
** positive
−
* smiles:
+
* right-end-position:
−
** ccccccccc=ccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** 235942
−
* inchi-key:
+
* left-end-position:
−
** jvefyxpcqbmmaa-zmlwrgbosa-j
+
** 232417
−
* molecular-weight:
+
* centisome-position:
−
** 969.83
+
** 63.401787   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN0-5393]]
+
* [[S.japonica_carotenoid_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
* [[RXN-14576]]
+
* [[3.1.26.4-RXN]]
−
* [[RXN-17783]]
+
** Category: [[annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: common-name=(2e,5z)-tetradecenoyl-coa}}
+
* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
−
{{#set: inchi-key=inchikey=jvefyxpcqbmmaa-zmlwrgbosa-j}}
+
** Category: [[annotation]]
−
{{#set: molecular-weight=969.83}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=235942}}
 +
{{#set: left-end-position=232417}}
 +
{{#set: centisome-position=63.401787    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=3}}

Latest revision as of 11:01, 18 March 2021

Gene SJ11813

  • transcription-direction:
    • positive
  • right-end-position:
    • 235942
  • left-end-position:
    • 232417
  • centisome-position:
    • 63.401787

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ11813&oldid=132046"