Difference between revisions of "SJ11252"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] == * common-name: ** hypoglycin a * smiles: ** c=c1(c(cc([n+])c([o-])=o)c1)...")
(Created page with "Category:gene == Gene SJ11252 == * transcription-direction: ** positive * right-end-position: ** 16612 * left-end-position: ** 16220 * centisome-position: ** 72.74521...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] ==
+
== Gene SJ11252 ==
* common-name:
+
* transcription-direction:
** hypoglycin a
+
** positive
* smiles:
+
* right-end-position:
** c=c1(c(cc([n+])c([o-])=o)c1)
+
** 16612
* inchi-key:
+
* left-end-position:
** oojzcxfxpzgubj-uhfffaoysa-n
+
** 16220
* molecular-weight:
+
* centisome-position:
** 141.169
+
** 72.74521   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-9157]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
{{#set: common-name=hypoglycin a}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=oojzcxfxpzgubj-uhfffaoysa-n}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=141.169}}
+
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=16612}}
 +
{{#set: left-end-position=16220}}
 +
{{#set: centisome-position=72.74521    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:01, 18 March 2021

Gene SJ11252

  • transcription-direction:
    • positive
  • right-end-position:
    • 16612
  • left-end-position:
    • 16220
  • centisome-position:
    • 72.74521

Organism(s) associated with this gene

Reaction(s) associated