Difference between revisions of "SJ02152"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9858 CPD-9858] == * common-name: ** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol * smi...")
(Created page with "Category:gene == Gene SJ02152 == * transcription-direction: ** positive * right-end-position: ** 41053 * left-end-position: ** 35728 * centisome-position: ** 25.445301...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9858 CPD-9858] ==
+
== Gene SJ02152 ==
−
* common-name:
+
* transcription-direction:
−
** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol
+
** positive
−
* smiles:
+
* right-end-position:
−
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c
+
** 41053
−
* inchi-key:
+
* left-end-position:
−
** wegxyvfdoluulo-tuumqracsa-n
+
** 35728
−
* molecular-weight:
+
* centisome-position:
−
** 616.966
+
** 25.445301   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-9227]]
+
* [[S.japonica_carotenoid_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[2.7.10.1-RXN]]
−
{{#set: common-name=2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=wegxyvfdoluulo-tuumqracsa-n}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=616.966}}
+
* [[2.7.12.1-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[PROTEIN-KINASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-14906]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=41053}}
 +
{{#set: left-end-position=35728}}
 +
{{#set: centisome-position=25.445301    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=4}}

Latest revision as of 11:01, 18 March 2021

Gene SJ02152

  • transcription-direction:
    • positive
  • right-end-position:
    • 41053
  • left-end-position:
    • 35728
  • centisome-position:
    • 25.445301

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ02152&oldid=132114"