Difference between revisions of "SJ20515"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-COA MALONYL-COA] == * common-name: ** malonyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)n...")
(Created page with "Category:gene == Gene SJ20515 == * transcription-direction: ** positive * right-end-position: ** 180303 * left-end-position: ** 144813 * centisome-position: ** 69.9009...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-COA MALONYL-COA] ==
+
== Gene SJ20515 ==
* common-name:
+
* transcription-direction:
** malonyl-coa
+
** positive
* smiles:
+
* right-end-position:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 180303
* inchi-key:
+
* left-end-position:
** ltyoqgrjfjakna-dvvlenmvsa-i
+
** 144813
* molecular-weight:
+
* centisome-position:
** 848.541
+
** 69.9009   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[S.japonica_carotenoid_curated]]
* [[ACOACXr]]
+
== Reaction(s) associated ==
* [[FATTY-ACID-SYNTHASE-RXN]]
+
* [[2.7.10.1-RXN]]
* [[MALONYL-COA-ACP-TRANSACYL-RXN]]
+
** Category: [[orthology]]
* [[MALONYL-COA-DECARBOXYLASE-RXN]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
+
* [[PROTEIN-KINASE-RXN]]
* [[RXN-10059]]
+
** Category: [[annotation]]
* [[RXN-10734]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-12777]]
+
* [[RXN-8443]]
* [[RXN-13294]]
+
** Category: [[orthology]]
* [[RXN-13295]]
+
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
* [[RXN-13296]]
+
== Pathway(s) associated ==
* [[RXN-13297]]
+
* [[PWY-5381]]
* [[RXN-13322]]
+
** '''6''' reactions found over '''11''' reactions in the full pathway
* [[RXN-13431]]
+
{{#set: transcription-direction=positive}}
* [[RXN-13441]]
+
{{#set: right-end-position=180303}}
* [[RXN-14492]]
+
{{#set: left-end-position=144813}}
* [[RXN-16016]]
+
{{#set: centisome-position=69.9009    }}
* [[RXN-16017]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
* [[RXN-16094]]
+
{{#set: nb reaction associated=3}}
* [[RXN-16153]]
+
{{#set: nb pathway associated=1}}
* [[RXN-3142]]
 
* [[RXN-7645]]
 
* [[RXN-7697]]
 
* [[RXN-9543]]
 
* [[RXN-9632]]
 
* [[RXN-9648]]
 
* [[RXN-9650]]
 
* [[RXN-9651]]
 
* [[RXN-9652]]
 
* [[RXN-9653]]
 
* [[RXN-9654]]
 
* [[RXN1G-368]]
 
* [[RXN1G-445]]
 
* [[RXN1G-499]]
 
</div>
 
== Reaction(s) known to produce the compound ==
 
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
 
* [[RXN0-5055]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=malonyl-coa}}
 
{{#set: inchi-key=inchikey=ltyoqgrjfjakna-dvvlenmvsa-i}}
 
{{#set: molecular-weight=848.541}}
 

Latest revision as of 11:01, 18 March 2021

Gene SJ20515

  • transcription-direction:
    • positive
  • right-end-position:
    • 180303
  • left-end-position:
    • 144813
  • centisome-position:
    • 69.9009

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-5381
    • 6 reactions found over 11 reactions in the full pathway