Difference between revisions of "SJ07978"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11241 CPD-11241] == * common-name: ** 4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturo...")
(Created page with "Category:gene == Gene SJ07978 == * transcription-direction: ** negative * right-end-position: ** 177076 * left-end-position: ** 172472 * centisome-position: ** 38.702003...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11241 CPD-11241] ==
+
== Gene SJ07978 ==
−
* common-name:
+
* transcription-direction:
−
** 4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturonate
+
** negative
−
* smiles:
+
* right-end-position:
−
** c([o-])(=o)c1(=cc(o)c(o)c(o1)oc2(c(o)c(c(o)oc(c([o-])=o)2)o))
+
** 177076
−
* inchi-key:
+
* left-end-position:
−
** llvvmxfnkahvez-gawnparcsa-l
+
** 172472
−
* molecular-weight:
+
* centisome-position:
−
** 350.235
+
** 38.702003   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_carotenoid_curated]]
−
* [[RXN-14897]]
+
== Reaction(s) associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[3.1.3.16-RXN]]
−
{{#set: common-name=4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturonate}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=llvvmxfnkahvez-gawnparcsa-l}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=350.235}}
+
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=177076}}
 +
{{#set: left-end-position=172472}}
 +
{{#set: centisome-position=38.702003    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=3}}

Latest revision as of 11:02, 18 March 2021

Gene SJ07978

  • transcription-direction:
    • negative
  • right-end-position:
    • 177076
  • left-end-position:
    • 172472
  • centisome-position:
    • 38.702003

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ07978&oldid=132477"