Difference between revisions of "SJ11243"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] == * common-name: ** carboxyphosphinopyruvate * smiles: ** c(p(c([o-])=o)(...")
(Created page with "Category:gene == Gene SJ11243 == * transcription-direction: ** positive * right-end-position: ** 133143 * left-end-position: ** 123662 * centisome-position: ** 32.81456...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] ==
+
== Gene SJ11243 ==
* common-name:
+
* transcription-direction:
** carboxyphosphinopyruvate
+
** positive
* smiles:
+
* right-end-position:
** c(p(c([o-])=o)([o-])=o)c(=o)c(=o)[o-]
+
** 133143
* inchi-key:
+
* left-end-position:
** ytkwpnbypyowcp-uhfffaoysa-k
+
** 123662
* molecular-weight:
+
* centisome-position:
** 193.029
+
** 32.81456   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-10828]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[RXN-10827]]
+
* [[PROTEIN-KINASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=carboxyphosphinopyruvate}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=ytkwpnbypyowcp-uhfffaoysa-k}}
+
{{#set: transcription-direction=positive}}
{{#set: molecular-weight=193.029}}
+
{{#set: right-end-position=133143}}
 +
{{#set: left-end-position=123662}}
 +
{{#set: centisome-position=32.81456    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:02, 18 March 2021

Gene SJ11243

  • transcription-direction:
    • positive
  • right-end-position:
    • 133143
  • left-end-position:
    • 123662
  • centisome-position:
    • 32.81456

Organism(s) associated with this gene

Reaction(s) associated