Difference between revisions of "SJ11887"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] == * common-name: ** indoxyl * smiles: ** c2(c=cc1(=c(c(o)=cn1)c=2)) * inchi-k...") |
(Created page with "Category:gene == Gene SJ11887 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * [[ATP_LPAREN_3h_RPAREN_tm]...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:gene]] |
− | == | + | == Gene SJ11887 == |
− | + | == Organism(s) associated with this gene == | |
− | + | * [[S.japonica_carotenoid_curated]] | |
− | + | == Reaction(s) associated == | |
− | + | * [[ATP_LPAREN_3h_RPAREN_tm]] | |
− | * | + | ** Category: [[orthology]] |
− | + | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a | |
− | + | {{#set: organism associated=S.japonica_carotenoid_curated}} | |
− | + | {{#set: nb reaction associated=1}} | |
− | == Reaction(s) | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: |
Latest revision as of 11:00, 18 March 2021
Gene SJ11887
Organism(s) associated with this gene
Reaction(s) associated
- ATP_LPAREN_3h_RPAREN_tm
- Category: orthology
- source: output_pantograph_nannochloropsis_salina; tool: pantograph; comment: n.a
- Category: orthology