Difference between revisions of "SJ07212"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2182 CPD-2182] == * common-name: ** 1-linoleoyl-2-linoleoyl-phosphatidylcholine * smiles: *...")
(Created page with "Category:gene == Gene SJ07212 == * transcription-direction: ** negative * right-end-position: ** 848200 * left-end-position: ** 843536 * centisome-position: ** 57.733887...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2182 CPD-2182] ==
+
== Gene SJ07212 ==
* common-name:
+
* transcription-direction:
** 1-linoleoyl-2-linoleoyl-phosphatidylcholine
+
** negative
* smiles:
+
* right-end-position:
** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
+
** 848200
* inchi-key:
+
* left-end-position:
** fvxdqwzbhixiej-lndkuqbdsa-n
+
** 843536
* molecular-weight:
+
* centisome-position:
** 782.092
+
** 57.733887   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-8323]]
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-8329]]
+
== Reaction(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[PROTEIN-KINASE-RXN]]
* [[RXN-8322]]
+
** Category: [[annotation]]
* [[RXN-8328]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
== Reaction(s) of unknown directionality ==
+
** Category: [[orthology]]
{{#set: common-name=1-linoleoyl-2-linoleoyl-phosphatidylcholine}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
{{#set: inchi-key=inchikey=fvxdqwzbhixiej-lndkuqbdsa-n}}
+
{{#set: transcription-direction=negative}}
{{#set: molecular-weight=782.092}}
+
{{#set: right-end-position=848200}}
 +
{{#set: left-end-position=843536}}
 +
{{#set: centisome-position=57.733887    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:02, 18 March 2021

Gene SJ07212

  • transcription-direction:
    • negative
  • right-end-position:
    • 848200
  • left-end-position:
    • 843536
  • centisome-position:
    • 57.733887

Organism(s) associated with this gene

Reaction(s) associated