Difference between revisions of "SJ18438"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17367 CPD-17367] == * common-name: ** (3r)-hydroxy-adrenoyl-coa * smiles: ** cccccc=ccc=ccc...")
(Created page with "Category:gene == Gene SJ18438 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 2.1.1.71-RXN ** Catego...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17367 CPD-17367] ==
+
== Gene SJ18438 ==
* common-name:
+
== Organism(s) associated with this gene  ==
** (3r)-hydroxy-adrenoyl-coa
+
* [[S.japonica_carotenoid_curated]]
* smiles:
+
== Reaction(s) associated ==
** cccccc=ccc=ccc=ccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
* [[2.1.1.71-RXN]]
* inchi-key:
+
** Category: [[orthology]]
** jhxlrlhtjymvbk-dhdhvehbsa-j
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* molecular-weight:
+
* [[RXN4FS-2]]
** 1094.012
+
** Category: [[orthology]]
== Reaction(s) known to consume the compound ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[RXN-16113]]
+
== Pathway(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[PWY-6825]]
* [[RXN-16112]]
+
** '''3''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[PWY4FS-3]]
{{#set: common-name=(3r)-hydroxy-adrenoyl-coa}}
+
** '''2''' reactions found over '''5''' reactions in the full pathway
{{#set: inchi-key=inchikey=jhxlrlhtjymvbk-dhdhvehbsa-j}}
+
* [[PWY4FS-4]]
{{#set: molecular-weight=1094.012}}
+
** '''1''' reactions found over '''5''' reactions in the full pathway
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=3}}

Latest revision as of 11:02, 18 March 2021

Gene SJ18438

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6825
    • 3 reactions found over 3 reactions in the full pathway
  • PWY4FS-3
    • 2 reactions found over 5 reactions in the full pathway
  • PWY4FS-4
    • 1 reactions found over 5 reactions in the full pathway