Difference between revisions of "SJ13652"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSAMINE-1P GLUCOSAMINE-1P] == * common-name: ** d-glucosamine 1-phosphate * smiles: ** c(o)...")
(Created page with "Category:gene == Gene SJ13652 == * transcription-direction: ** positive * right-end-position: ** 55134 * left-end-position: ** 45805 * centisome-position: ** 13.796188...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSAMINE-1P GLUCOSAMINE-1P] ==
+
== Gene SJ13652 ==
* common-name:
+
* transcription-direction:
** d-glucosamine 1-phosphate
+
** positive
* smiles:
+
* right-end-position:
** c(o)c1(oc(op(=o)([o-])[o-])c([n+])c(o)c(o)1)
+
** 55134
* inchi-key:
+
* left-end-position:
** ymjbyrvfgyxulk-qzabapfnsa-m
+
** 45805
* molecular-weight:
+
* centisome-position:
** 258.144
+
** 13.796188   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[2.3.1.157-RXN]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[2.7.11.30-RXN]]
{{#set: common-name=d-glucosamine 1-phosphate}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=ymjbyrvfgyxulk-qzabapfnsa-m}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=258.144}}
+
* [[PROTEIN-KINASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=55134}}
 +
{{#set: left-end-position=45805}}
 +
{{#set: centisome-position=13.796188    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}

Latest revision as of 11:02, 18 March 2021

Gene SJ13652

  • transcription-direction:
    • positive
  • right-end-position:
    • 55134
  • left-end-position:
    • 45805
  • centisome-position:
    • 13.796188

Organism(s) associated with this gene

Reaction(s) associated