Difference between revisions of "SJ19643"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-N-ACETYL-D-GLUCOSAMINE UDP-N-ACETYL-D-GLUCOSAMINE] == * common-name: ** udp-n-acetyl-&alpha...")
(Created page with "Category:gene == Gene SJ19643 == * transcription-direction: ** negative * right-end-position: ** 220515 * left-end-position: ** 216257 * centisome-position: ** 96.65074...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-N-ACETYL-D-GLUCOSAMINE UDP-N-ACETYL-D-GLUCOSAMINE] ==
+
== Gene SJ19643 ==
−
* common-name:
+
* transcription-direction:
−
** udp-n-acetyl-α-d-glucosamine
+
** negative
−
* smiles:
+
* right-end-position:
−
** cc(=o)nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(nc2=o)=o))o)o))([o-])=o)([o-])=o)oc(c(c3o)o)co)
+
** 220515
−
* inchi-key:
+
* left-end-position:
−
** lftytuazoprmmi-cfrasdgpsa-l
+
** 216257
−
* molecular-weight:
+
* centisome-position:
−
** 605.342
+
** 96.65074   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[2.4.1.101-RXN]]
+
* [[S.japonica_carotenoid_curated]]
−
* [[2.4.1.141-RXN]]
+
== Reaction(s) associated ==
−
* [[2.4.1.145-RXN]]
+
* [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]]
−
* [[2.4.1.155-RXN]]
+
** Category: [[annotation]]
−
* [[2.4.1.198-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[2.4.1.201-RXN]]
+
{{#set: transcription-direction=negative}}
−
* [[2.4.1.223-RXN]]
+
{{#set: right-end-position=220515}}
−
* [[2.4.1.224-RXN]]
+
{{#set: left-end-position=216257}}
−
* [[2.4.1.229-RXN]]
+
{{#set: centisome-position=96.65074    }}
−
* [[2.4.1.94-RXN]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
−
* [[2.7.8.15-RXN]]
+
{{#set: nb reaction associated=1}}
−
* [[2.7.8.17-RXN]]
 
−
* [[RXN-11627]]
 
−
* [[RXN-11889]]
 
−
* [[RXN-11890]]
 
−
* [[RXN-15205]]
 
−
* [[RXN-6501]]
 
−
* [[RXN-7873]]
 
−
* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
 
−
== Reaction(s) known to produce the compound ==
 
−
* [[2.4.1.198-RXN]]
 
−
* [[2.4.1.229-RXN]]
 
−
* [[2.4.1.94-RXN]]
 
−
* [[NAG1P-URIDYLTRANS-RXN]]
 
−
* [[RXN-11627]]
 
−
* [[RXN-11889]]
 
−
* [[RXN-11890]]
 
−
* [[RXN-7873]]
 
−
* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
 
−
== Reaction(s) of unknown directionality ==
 
−
{{#set: common-name=udp-n-acetyl-α-d-glucosamine}}
 
−
{{#set: inchi-key=inchikey=lftytuazoprmmi-cfrasdgpsa-l}}
 
−
{{#set: molecular-weight=605.342}}
 

Latest revision as of 11:03, 18 March 2021

Gene SJ19643

  • transcription-direction:
    • negative
  • right-end-position:
    • 220515
  • left-end-position:
    • 216257
  • centisome-position:
    • 96.65074

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ19643&oldid=132968"