Difference between revisions of "SJ10758"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-I-CIT HOMO-I-CIT] == * common-name: ** (1r,2s)-homoisocitrate * smiles: ** c(cc(=o)[o-])c(...")
(Created page with "Category:gene == Gene SJ10758 == * transcription-direction: ** positive * right-end-position: ** 120253 * left-end-position: ** 110924 * centisome-position: ** 28.83592...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-I-CIT HOMO-I-CIT] ==
+
== Gene SJ10758 ==
* common-name:
+
* transcription-direction:
** (1r,2s)-homoisocitrate
+
** positive
* smiles:
+
* right-end-position:
** c(cc(=o)[o-])c(c(=o)[o-])c(o)c(=o)[o-]
+
** 120253
* inchi-key:
+
* left-end-position:
** oejzzcgrgvfwhk-wvzvxsggsa-k
+
** 110924
* molecular-weight:
+
* centisome-position:
** 203.128
+
** 28.83592   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[HOMOACONITATE-HYDRATASE-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-13722]]
+
== Reaction(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[PROTEIN-KINASE-RXN]]
* [[HOMOACONITATE-HYDRATASE-RXN]]
+
** Category: [[annotation]]
* [[RXN-13722]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
== Reaction(s) of unknown directionality ==
+
** Category: [[orthology]]
{{#set: common-name=(1r,2s)-homoisocitrate}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
{{#set: inchi-key=inchikey=oejzzcgrgvfwhk-wvzvxsggsa-k}}
+
* [[RNA-POLYMERASE-SUBUNIT-KINASE-RXN]]
{{#set: molecular-weight=203.128}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=120253}}
 +
{{#set: left-end-position=110924}}
 +
{{#set: centisome-position=28.83592    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}

Latest revision as of 11:03, 18 March 2021

Gene SJ10758

  • transcription-direction:
    • positive
  • right-end-position:
    • 120253
  • left-end-position:
    • 110924
  • centisome-position:
    • 28.83592

Organism(s) associated with this gene

Reaction(s) associated